CAS 2922-45-4
:pyridine-3-sulfonamide
Description:
Pyridine-3-sulfonamide, with the CAS number 2922-45-4, is an organic compound characterized by the presence of a pyridine ring substituted with a sulfonamide group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the sulfonamide functional group, which enhances its hydrophilicity. Pyridine-3-sulfonamide exhibits properties typical of sulfonamides, including potential antibacterial activity, making it of interest in medicinal chemistry. The presence of the nitrogen atom in the pyridine ring contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, this compound can serve as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Its stability under standard conditions and reactivity with electrophiles further enhance its utility in organic synthesis. Overall, pyridine-3-sulfonamide is a versatile compound with applications in both research and industry.
Formula:C5H6N2O2S
InChI:InChI=1/C5H6N2O2S/c6-10(8,9)5-2-1-3-7-4-5/h1-4H,(H2,6,8,9)
SMILES:c1cc(cnc1)S(=O)(=O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyridine-3-sulphonamide
CAS:Pyridine-3-sulphonamideFormula:C5H6N2O2SPurity:98%Color and Shape: pale yellow solidMolecular weight:158.18g/molpyridine-3-sulfonamide
CAS:Controlled Product<p>Applications pyridine-3-sulfonamide (cas# 2922-45-4) is a useful research chemical.<br></p>Formula:C5H6N2O2SColor and Shape:NeatMolecular weight:158.18Pyridine-3-sulfonamide
CAS:<p>Pyridine-3-sulfonamide is a diazonium salt that has shown anticancer activity against human colon HCT116 cells. It inhibits the proliferation of leukemia cells by inhibiting the uptake of glucose, and it also has inhibitory properties on l1210 murine leukemia cells. Pyridine-3-sulfonamide binds to metal surfaces and accumulates in the cytoplasm of cancer cells, which may be due to its structural formula consisting of a pyridine group and a sulfonamide group. This compound can be used as an anticancer drug for cancer treatment.</p>Formula:C5H6N2O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:158.18 g/mol




