CAS 2922-83-0: L-Kynurenine
Description:L-Kynurenine is an amino acid derivative and a key intermediate in the metabolism of the essential amino acid tryptophan. It is characterized by its role in the kynurenine pathway, which is significant in the biosynthesis of several bioactive compounds, including neurotransmitters and neuroactive metabolites. L-Kynurenine is known for its potential neuroprotective and immunomodulatory properties, making it a subject of interest in research related to neurodegenerative diseases and psychiatric disorders. The compound is typically a yellowish crystalline solid, soluble in water and various organic solvents. Its structure features an indole ring, which is characteristic of tryptophan derivatives, and it can exist in different tautomeric forms. L-Kynurenine has been studied for its effects on the central nervous system, including its influence on serotonin levels and its role in inflammation. Additionally, it has been implicated in various physiological processes, including immune response and oxidative stress regulation. Overall, L-Kynurenine is a significant compound in both biochemical research and potential therapeutic applications.
Formula:C10H12N2O3
InChI:InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1
InChI key:InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N
SMILES:O=C(O)C(N)CC(=O)C=1C=CC=CC1N
- Synonyms:
- (2S)-4-(2-Aminophenyl)-2-azaniumyl-4-oxobutanoate
- (αS)-α,2-Diamino-γ-oxobenzenebutanoic acid
- 3-Anthraniloylalanine
- <span class="text-smallcaps">L</span>-3-(o-Aminobenzoyl)alanine
- <span class="text-smallcaps">L</span>-Kynurenine
- Alanine, 3-anthraniloyl-, <span class="text-smallcaps">L</span>-
- Benzenebutanoic acid, α,2-diamino-γ-oxo-, (S)-
- Benzenebutanoic acid, α,2-diamino-γ-oxo-, (αS)-
- Kynurenin
- Kynurenine
- See more synonyms
- L-Kynurenine
- Alanine, 3-anthraniloyl-, L-
