CAS 2922-94-3
:cytidine 3',5'-bis(dihydrogen phosphate)
Description:
Cytidine 3',5'-bis(dihydrogen phosphate), commonly referred to as cytidine diphosphate (CDP), is a nucleotide derivative that plays a crucial role in cellular metabolism and biochemistry. This compound consists of a cytidine base linked to a ribose sugar, which is further phosphorylated at both the 3' and 5' positions by phosphate groups. It is a key intermediate in the synthesis of RNA and is involved in various biochemical pathways, including the synthesis of phospholipids and nucleotides. CDP is soluble in water and exhibits acidic properties due to the presence of phosphate groups, which can donate protons in solution. Its structure allows it to participate in enzymatic reactions, serving as a substrate for kinases and other enzymes. Additionally, CDP can be converted into other nucleotides, highlighting its importance in nucleotide metabolism. Overall, cytidine 3',5'-bis(dihydrogen phosphate) is essential for cellular functions, particularly in the context of nucleic acid synthesis and energy transfer within the cell.
Formula:C9H15N3O11P2
InChI:InChI=1/C9H15N3O11P2/c10-5-1-2-12(9(14)11-5)8-6(13)7(23-25(18,19)20)4(22-8)3-21-24(15,16)17/h1-2,4,6-8,13H,3H2,(H2,10,11,14)(H2,15,16,17)(H2,18,19,20)/t4-,6-,7-,8-/m1/s1
SMILES:c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O2)OP(=O)(O)O)O)c(nc1=N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cytidine 3',5'-bisphosphate
CAS:Controlled ProductFormula:C9H15N3O11P2Color and Shape:NeatMolecular weight:403.176Cytidine 3',5'-bisphosphate sodium
CAS:<p>Cytidine 3',5'-bisphosphate sodium is a phospholipid that is found in the cell membrane of gram-positive bacteria. Cytidine 3',5'-bisphosphate sodium has been shown to be produced by the enzyme phosphatidylcholine synthase, which converts phosphatidylethanolamine and cytidine 5'-monophosphate into phosphatidylcholine and cytidine 3',5'-bisphosphate. The presence of this compound in the cell membrane may be an indication of long-term survival and growth under laboratory conditions. It is also present in the ribosomal RNA of type strain organisms.</p>Formula:C9H15N3O11P2•NaxPurity:Min. 95%Molecular weight:403.18 g/mol
