CAS 2924-46-1
:4-[4-(3-chlorophenyl)-4-(pyrrolidin-1-ylcarbonyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one
Description:
The chemical substance known as "4-[4-(3-chlorophenyl)-4-(pyrrolidin-1-ylcarbonyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one," with the CAS number 2924-46-1, is a synthetic compound that belongs to the class of piperidine derivatives. It features a complex structure characterized by multiple functional groups, including a piperidine ring, a pyrrolidine moiety, and aromatic rings with halogen substituents. This compound is often studied for its potential pharmacological properties, particularly in the context of neuropharmacology, due to its structural similarity to various psychoactive substances. The presence of chlorine and fluorine atoms in its structure may influence its biological activity and lipophilicity, affecting how it interacts with biological targets. Additionally, the carbonyl group contributes to its reactivity and potential interactions in biological systems. As with many synthetic compounds, understanding its characteristics, including solubility, stability, and reactivity, is crucial for assessing its applications in research and potential therapeutic uses.
Formula:C26H30ClFN2O2
InChI:InChI=1/C26H30ClFN2O2/c27-22-6-3-5-21(19-22)26(25(32)30-15-1-2-16-30)12-17-29(18-13-26)14-4-7-24(31)20-8-10-23(28)11-9-20/h3,5-6,8-11,19H,1-2,4,7,12-18H2
SMILES:C1CCN(C1)C(=O)C1(CCN(CCCC(=O)c2ccc(cc2)F)CC1)c1cccc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Haloperidide
CAS:Haloperidide is an antiemetic.Formula:C26H30ClFN2O2Color and Shape:SolidMolecular weight:456.98
