CAS 2924-67-6
:Fluoresone
Description:
Fluoresone, with the CAS number 2924-67-6, is a synthetic organic compound known for its fluorescent properties. It belongs to the class of compounds known as xanthene dyes, which are characterized by their vibrant colors and ability to absorb and emit light. Fluoresone exhibits a strong fluorescence under ultraviolet light, making it useful in various applications, including fluorescence microscopy and as a tracer in biochemical assays. The compound typically appears as a yellow to orange solid and is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. Its chemical structure features a xanthene backbone, which contributes to its photophysical properties. Fluoresone is often utilized in research and industrial applications due to its stability and sensitivity to environmental changes, such as pH and solvent polarity. Safety precautions should be taken when handling this compound, as with many organic dyes, due to potential toxicity and environmental impact.
Formula:C8H9FO2S
InChI:InChI=1S/C8H9FO2S/c1-2-12(10,11)8-5-3-7(9)4-6-8/h3-6H,2H2,1H3
InChI key:InChIKey=PRNNIHPVNFPWAH-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C1=CC=C(F)C=C1
Synonyms:- 1-(Ethanesulfonyl)-4-fluorobenzene
- 1-(Ethylsulfonyl)-4-Fluorobenzene
- 4-(Ethylsulfonyl)-1-fluorobenzene
- 4-Fluorophenyl ethyl sulfone
- Anp 215
- Benzene, 1-(ethylsulfonyl)-4-fluoro-
- Bripadon
- Caducid
- Ethyl 4-Fluorophenyl Sulphone
- Ethyl p-fluorophenyl sulfone
- Floretione
- Fluoreson
- Sulfone, ethyl p-fluorophenyl
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Ethanesulphonyl-4-fluorobenzene
CAS:1-Ethanesulphonyl-4-fluorobenzeneFormula:C8H9FO2SPurity:≥95%Color and Shape: pale yellow low melting crystalsMolecular weight:188.22g/mol1-Ethanesulphonyl-4-fluorobenzene
CAS:<p>1-Ethanesulphonyl-4-fluorobenzene is a chemical compound that belongs to the group of fluorinated drugs. It has been used as a drug for the treatment of cancer and inflammatory diseases, such as epilepsy and inflammatory bowel disease. This polymer is biocompatible, which means it does not cause an adverse reaction in living tissue. 1-Ethanesulphonyl-4-fluorobenzene has a wide spectrum of biological properties and is able to inhibit water vapor transport through occlusive polymer matrices. The use of this polymer can be beneficial in the development of new drug delivery systems because it has low toxicity and high stability.</p>Formula:C8H9FO2SPurity:Min. 95%Molecular weight:188.22 g/mol


