CAS 2924-95-0
:N-(4-Trifluoromethylphenyl)propionamide
Description:
N-(4-Trifluoromethylphenyl)propionamide, with the CAS number 2924-95-0, is an organic compound characterized by its amide functional group and a trifluoromethyl substituent on the aromatic ring. This compound typically exhibits a white to off-white crystalline appearance. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The propionamide structure contributes to its potential as a building block in organic synthesis and medicinal chemistry. Its molecular interactions may be influenced by hydrogen bonding due to the amide group, which can affect solubility and reactivity. Additionally, the trifluoromethyl group can impart unique electronic properties, potentially affecting the compound's stability and reactivity in various chemical environments. Overall, N-(4-Trifluoromethylphenyl)propionamide is a compound of interest for its unique structural features and potential applications in various fields, including drug development and materials science.
Formula:C10H10F3NO
InChI:InChI=1/C10H10F3NO/c1-2-9(15)14-8-5-3-7(4-6-8)10(11,12)13/h3-6H,2H2,1H3,(H,14,15)
SMILES:CCC(=O)Nc1ccc(cc1)C(F)(F)F
Synonyms:- N-[4-(trifluoromethyl)phenyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
