CAS 29241-64-3

5,6-dibromopyridine-3-carboxylic acid

Description:

5,6-Dibromopyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure, which is substituted at the 5 and 6 positions with bromine atoms and at the 3 position with a carboxylic acid group. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The bromine substituents enhance the compound's reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure contributes to its potential applications in organic synthesis, where it can serve as an intermediate in the preparation of more complex molecules. Additionally, the presence of halogens often influences the compound's physical properties, such as melting point and boiling point, as well as its behavior in chemical reactions. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₃Br₂NO₂

InChI: InChI=1/C6H3Br2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)

SMILES: c1c(cnc(c1Br)Br)C(=O)O

Synonyms:

• 3-Pyridinecarboxylic acid, 5,6-dibromo-
• 5,6-Dibromonicotinic acid

3-Pyridinecarboxylic acid, 5,6-dibromo-

CAS: 29241-64-3

Formula: C₆H₃Br₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 280.9015

Ref: IN-DA002XT8

5,6-Dibromonicotinic acid

CAS: 29241-64-3

5,6-Dibromonicotinic acid

Purity: 98%

Molecular weight: 280.90152g/mol

Ref: 54-OR183418

5,6-Dibromonicotinic Acid

Controlled Product

CAS: 29241-64-3

Applications 5,6-dibromonicotinic acid (cas# 29241-64-3) is a useful research chemical.

Formula: C₆H₃Br₂NO₂

Color and Shape: Neat

Molecular weight: 280.901

Ref: TR-B426188

5,6-Dibromonicotinic acid

CAS: 29241-64-3

Formula: C₆H₃Br₂NO₂

Purity: 97%

Color and Shape: Solid, Powder

Molecular weight: 280.903

Ref: 10-F045310