CAS 29241-65-4
:5-Bromo-2-chloronicotinic acid
Description:
5-Bromo-2-chloronicotinic acid is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a pyridine ring, specifically at the 5 and 2 positions, respectively. This compound features a carboxylic acid functional group, which contributes to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The presence of halogens (bromine and chlorine) can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in drug development. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental concerns.
Formula:C6H3BrClNO2
InChI:InChI=1/C6H3BrClNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)
SMILES:c1c(cnc(c1C(=O)O)Cl)Br
Synonyms:- 3-Pyridinecarboxylic acid, 5-bromo-2-chloro-
- Acide 5-Bromo-2-Chloronicotinique
- 5-Bromo-2-Chloropyridine-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-chloronicotinic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrClNO2Purity:96%Molecular weight:236.453-Pyridinecarboxylic acid, 5-bromo-2-chloro-
CAS:Formula:C6H3BrClNO2Purity:96%Color and Shape:SolidMolecular weight:236.45055-Bromo-2-chloronicotinic acid
CAS:5-Bromo-2-chloronicotinic acidFormula:C6H3BrClNO2Purity:97%Color and Shape: off-white to faint brown powderMolecular weight:236.45g/mol5-Bromo-2-chloronicotinic Acid
CAS:Formula:C6H3BrClNO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:236.455-Bromo-2-chloronicotinic acid
CAS:Formula:C6H3BrClNO2Purity:96%Color and Shape:SolidMolecular weight:236.45




