CymitQuimica logo

CAS 29241-65-4

:

5-Bromo-2-chloronicotinic acid

Description:
5-Bromo-2-chloronicotinic acid is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a pyridine ring, specifically at the 5 and 2 positions, respectively. This compound features a carboxylic acid functional group, which contributes to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The presence of halogens (bromine and chlorine) can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in drug development. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental concerns.
Formula:C6H3BrClNO2
InChI:InChI=1/C6H3BrClNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)
InChI key:UKNYSJCAGUXDOQ-UHFFFAOYSA-N
SMILES:c1c(cnc(c1C(=O)O)Cl)Br
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-bromo-2-chloro-
  • Acide 5-Bromo-2-Chloronicotinique
  • 5-Bromo-2-Chloropyridine-3-Carboxylic Acid
Found 6 products.