CAS 29241-66-5

5-Bromo-2-fluoronicotinic acid

Description:

5-Bromo-2-fluoronicotinic acid is a heterocyclic organic compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with both a bromine atom at the 5-position and a fluorine atom at the 2-position, along with a carboxylic acid functional group. This compound is characterized by its polar nature due to the presence of the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The bromine and fluorine substituents contribute to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of these halogens can influence the compound's electronic properties, making it a valuable intermediate in organic synthesis. Additionally, 5-Bromo-2-fluoronicotinic acid may exhibit biological activity, which can be explored in various research contexts, including drug discovery and agrochemical applications. Its unique structural features make it a compound of interest in both academic and industrial settings.

Formula: C₆H₃BrFNO₂

InChI: InChI=1/C6H3BrFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)

SMILES: c1c(cnc(c1C(=O)O)F)Br

Synonyms:

• 3-Pyridinecarboxylic acid, 5-bromo-2-fluoro-

3-Pyridinecarboxylic acid, 5-bromo-2-fluoro-

CAS: 29241-66-5

Formula: C₆H₃BrFNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.9959

Ref: IN-DA002XUC

5-Bromo-2-fluoronicotinic acid

CAS: 29241-66-5

Purity: 98%

Molecular weight: 219.996

Ref: FT-B13012

5-Bromo-2-fluoronicotinic acid

CAS: 29241-66-5

5-Bromo-2-fluoronicotinic acid

Purity: 97%

Molecular weight: 220.00g/mol

Ref: 54-PC57029

5-Bromo-2-fluoronicotinic acid

CAS: 29241-66-5

5-Bromo-2-fluoronicotinic acid is a crystalline compound with an orthorhombic crystal system. The crystal structure of 5-bromo-2-fluoronicotinic acid monohydrate was determined by X-ray diffraction and refined to 2.5 Å resolution. The space group was found to be P212121 and the unit cell dimensions are a = 9.716 Å, b = 10.867 Å, c = 12.242 Å and β = 106.9°. The molecular weight of 5-bromo-2-fluoronicotinic acid monohydrate was found to be 277.3 g/mol with an elemental analysis of C: 67% H: 7% F: 16%.

Formula: C₆H₃BrFNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 220 g/mol

Ref: 3D-NB67359

5-Bromo-2-fluoronicotinic acid

CAS: 29241-66-5

Formula: C₆H₃BrFNO₂

Purity: 95%

Color and Shape: Liquid, Oil

Molecular weight: 219.997

Ref: 10-F076809