CAS 29241-66-5
:5-Bromo-2-fluoronicotinic acid
Description:
5-Bromo-2-fluoronicotinic acid is a heterocyclic organic compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with both a bromine atom at the 5-position and a fluorine atom at the 2-position, along with a carboxylic acid functional group. This compound is characterized by its polar nature due to the presence of the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The bromine and fluorine substituents contribute to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of these halogens can influence the compound's electronic properties, making it a valuable intermediate in organic synthesis. Additionally, 5-Bromo-2-fluoronicotinic acid may exhibit biological activity, which can be explored in various research contexts, including drug discovery and agrochemical applications. Its unique structural features make it a compound of interest in both academic and industrial settings.
Formula:C6H3BrFNO2
InChI:InChI=1/C6H3BrFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)
SMILES:c1c(cnc(c1C(=O)O)F)Br
Synonyms:- 3-Pyridinecarboxylic acid, 5-bromo-2-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Pyridinecarboxylic acid, 5-bromo-2-fluoro-
CAS:Formula:C6H3BrFNO2Purity:98%Color and Shape:SolidMolecular weight:219.99595-Bromo-2-fluoronicotinic acid
CAS:5-Bromo-2-fluoronicotinic acidPurity:97%Molecular weight:220.00g/mol5-Bromo-2-fluoronicotinic acid
CAS:5-Bromo-2-fluoronicotinic acid is a crystalline compound with an orthorhombic crystal system. The crystal structure of 5-bromo-2-fluoronicotinic acid monohydrate was determined by X-ray diffraction and refined to 2.5 Å resolution. The space group was found to be P212121 and the unit cell dimensions are a = 9.716 Å, b = 10.867 Å, c = 12.242 Å and β = 106.9°. The molecular weight of 5-bromo-2-fluoronicotinic acid monohydrate was found to be 277.3 g/mol with an elemental analysis of C: 67% H: 7% F: 16%.Formula:C6H3BrFNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:220 g/mol5-Bromo-2-fluoronicotinic acid
CAS:Formula:C6H3BrFNO2Purity:95%Color and Shape:Liquid, OilMolecular weight:219.997




