CAS 292615-41-9
:2-Mercaptobenzoic acid 2-(2-mercaptobenzoyl)hydrazide
Description:
2-Mercaptobenzoic acid 2-(2-mercaptobenzoyl)hydrazide, identified by its CAS number 292615-41-9, is a chemical compound that features both mercapto and hydrazide functional groups, which contribute to its reactivity and potential applications. This substance typically appears as a solid and is characterized by its ability to form hydrogen bonds due to the presence of the hydrazide moiety, enhancing its solubility in polar solvents. The mercapto groups provide thiol functionality, which can participate in various chemical reactions, including nucleophilic substitutions and metal chelation. The compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or as a building block for more complex molecules. Additionally, the presence of aromatic rings in its structure may contribute to its stability and interaction with other chemical entities. Overall, 2-Mercaptobenzoic acid 2-(2-mercaptobenzoyl)hydrazide is a versatile compound with significant implications in various fields of research.
Formula:C14H12N2O2S2
InChI:InChI=1/C14H12N2O2S2/c17-13(9-5-1-3-7-11(9)19)15-16-14(18)10-6-2-4-8-12(10)20/h1-8,19-20H,(H,15,17)(H,16,18)
InChI key:InChIKey=BCDWFVITTFIUNV-UHFFFAOYSA-N
SMILES:C(NNC(=O)C1=C(S)C=CC=C1)(=O)C2=C(S)C=CC=C2
Synonyms:- 2-Mercaptobenzoic acid 2-(2-mercaptobenzoyl)hydrazide
- 2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide
- Benzoic Acid, 2-Mercapto-, 2-(2-Mercaptobenzoyl)Hydrazide
- NSC 691995
- NSC 704784
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Benzoic acid, 2-mercapto-, 2-(2-mercaptobenzoyl)hydrazide
CAS:Formula:C14H12N2O2S2Color and Shape:SolidMolecular weight:304.3873N,N’-Bis(2-mercaptobenzoyl)hydrazide
CAS:Controlled ProductStability Air Sensitive
Applications A selective inhibitor of HIV-1 integrase. Has no other effect on other retroviral targets, including reverse transcriptase, protease, and virus attachement, and exhibits no detectable activity against human topoisomerases I and II at concentrations that effectively inhibit integrase.
References Neamati, N., et al.: J. Med. Chem., 45, 5661 (2003)Formula:C14H12N2O2S2Color and Shape:NeatMolecular weight:304.39


