CAS 292636-09-0

7-bromo-4-fluoro-1H-indole

Description:

7-Bromo-4-fluoro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine and fluorine substituents at the 7 and 4 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The bromine atom can participate in electrophilic substitution reactions, while the fluorine atom can enhance the compound's lipophilicity and metabolic stability. Additionally, 7-bromo-4-fluoro-1H-indole may exhibit interesting photophysical properties, making it a candidate for applications in materials science and organic electronics. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, this compound serves as a valuable building block in synthetic organic chemistry and drug discovery.

Formula: C₈H₅BrFN

InChI: InChI=1/C8H5BrFN/c9-6-1-2-7(10)5-3-4-11-8(5)6/h1-4,11H

SMILES: c1cc(c2cc[nH]c2c1Br)F

Synonyms:

• 1H-indole, 7-bromo-4-fluoro-
• 7-Bromo-4-fluoro-1H-indole

1H-Indole, 7-bromo-4-fluoro-

CAS: 292636-09-0

Formula: C₈H₅BrFN

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.0344

Ref: IN-DA002XW8

7-Bromo-4-fluoro-1H-indole

CAS: 292636-09-0

7-Bromo-4-fluoro-1H-indole

Purity: 98%

Color and Shape: White Powder

Molecular weight: 214.03g/mol

Ref: 54-PC7088

7-Bromo-4-fluoro-1H-indole

CAS: 292636-09-0

Formula: C₈H₅BrFN

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.037

Ref: 10-F219746