CAS 2927-34-6
:3,4-Difluorotoluene
Description:
3,4-Difluorotoluene, with the CAS number 2927-34-6, is an aromatic hydrocarbon characterized by the presence of two fluorine atoms and a methyl group attached to a benzene ring. Specifically, the fluorine atoms are positioned at the 3 and 4 positions relative to the methyl group, making it a derivative of toluene. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is known for its relatively low boiling point and moderate solubility in organic solvents, while being less soluble in water. 3,4-Difluorotoluene exhibits chemical stability under standard conditions but can participate in electrophilic substitution reactions typical of aromatic compounds. Its fluorine substituents can influence its reactivity and physical properties, such as polarity and boiling point. This compound is utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds, highlighting its significance in organic chemistry and industrial processes.
Formula:C7H6F2
InChI:InChI=1/C7H6F2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3
SMILES:Cc1ccc(c(c1)F)F
Synonyms:- 1,2-Difluor-4-methylbenzol
- 1,2-Difluoro-4-methylbenzene
- Benzene, 1,2-difluoro-4-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Difluorotoluene
CAS:Formula:C7H6F2Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:128.123,4-Difluorotoluene, 98%
CAS:Used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part
Formula:C7H6F2Purity:98%Molecular weight:128.12Benzene, 1,2-difluoro-4-methyl-
CAS:Formula:C7H6F2Purity:98%Color and Shape:LiquidMolecular weight:128.11933,4-Difluorotoluene
CAS:3,4-DifluorotolueneFormula:C7H6F2Purity:99%Color and Shape: clear. colourless liquidMolecular weight:128.12g/mol




