CAS 2927-71-1
:2,4-Dichloro-5-fluoropyrimidine
Description:
2,4-Dichloro-5-fluoropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features two chlorine atoms at the 2 and 4 positions and a fluorine atom at the 5 position of the pyrimidine ring, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow solid at room temperature and is soluble in organic solvents. The presence of halogen substituents enhances its potential as an intermediate in the synthesis of pharmaceuticals and agrochemicals, particularly in the development of herbicides and antiviral agents. Additionally, 2,4-Dichloro-5-fluoropyrimidine exhibits moderate toxicity, necessitating careful handling and storage. Its chemical structure allows for various reactions, including nucleophilic substitutions and coupling reactions, making it a valuable compound in organic synthesis and medicinal chemistry.
Formula:C4HCl2FN2
InChI:InChI=1S/C4HCl2FN2/c5-3-2(7)1-8-4(6)9-3/h1H
InChI key:InChIKey=WHPFEQUEHBULBW-UHFFFAOYSA-N
SMILES:ClC=1C(F)=CN=C(Cl)N1
Synonyms:- 2,4-Dichloro-5-Fluoropyrimidin
- 2,4-Dichloro-5-fluoro-pyrimidine
- 2,4-Dichloro-5-fluoropyrimidine
- 2,6-Dichloro-5-fluoropyrimidine
- 5-Fluoro-2,4-dichloropyrimdine
- 5-Fluoro-2,4-dichloropyrimidine
- NSC 70442
- Potassium 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-Sulfonate
- Pyrimidine, 2,4-dichloro-5-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
2,4-Dichloro-5-fluoropyrimidine
CAS:Formula:C4HCl2FN2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to lumpMolecular weight:166.96Pyrimidine, 2,4-dichloro-5-fluoro-
CAS:Formula:C4HCl2FN2Purity:97%Color and Shape:SolidMolecular weight:166.96855-Fluoro-2,4-dichloropyrimidine
CAS:Formula:C4HCl2FN2Purity:≥ 98.0%Color and Shape:Off-white to light-yellow solidMolecular weight:166.972,4-Dichloro-5-fluoropyrimidine
CAS:2,4-Dichloro-5-fluoropyrimidineFormula:C4HCl2FN2Purity:98%Color and Shape: white to light yellow solidMolecular weight:166.97g/mol2,4-Dichloro-5-fluoropyrimidine
CAS:Formula:C4HCl2FN2Purity:97%Color and Shape:Solid, Chunks or Crystalline PowderMolecular weight:166.965-Fluoro-2,4-dichloropyrimidine
CAS:Controlled ProductFormula:C4HCl2FN2Color and Shape:NeatMolecular weight:166.972,4-Dichloro-5-fluoropyrimidine
CAS:2,4-Dichloro-5-fluoropyrimidine is an aromatic hydrocarbon that has been shown to inhibit the growth of mouse tumor cells in vitro. It also inhibits the production of amines by reacting with industrial chemicals and sodium carbonate. This compound has potent inhibitory activity against autoimmune diseases and cytotoxic potency on mcf-7 cells. Furthermore, 2,4-Dichloro-5-fluoropyrimidine has been shown to have a chlorinating effect on cancer cells.
Formula:C4HCl2FN2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:166.97 g/mol








