CAS 29274-22-4

4H-pyrazolo[1,5-a]pyrimidin-5-one

Description:

4H-pyrazolo[1,5-a]pyrimidin-5-one is a heterocyclic organic compound characterized by its fused pyrazole and pyrimidine rings. This compound features a five-membered pyrazole ring and a six-membered pyrimidine ring, with a carbonyl group at the 5-position of the pyrazole. It is typically a crystalline solid and may exhibit properties such as solubility in polar organic solvents. The presence of nitrogen atoms in its structure contributes to its potential biological activity, making it of interest in medicinal chemistry. Compounds of this class may exhibit various pharmacological properties, including anti-inflammatory and anti-cancer activities. The molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, its unique ring system may facilitate further chemical modifications to enhance its efficacy or selectivity. As with many heterocycles, the stability and reactivity of 4H-pyrazolo[1,5-a]pyrimidin-5-one can be influenced by substituents on the rings, making it a versatile compound for synthetic chemistry applications.

Formula: C₆H₅N₃O

InChI: InChI=1/C6H5N3O/c10-6-2-4-9-5(8-6)1-3-7-9/h1-4H,(H,8,10)

SMILES: c1cnn2ccc(=O)[nH]c12

Synonyms:

• 5-Hydroxypyrazolo[1,5-a]pyrimidine
• pyrazolo[1,5-a]pyrimidin-5(4H)-one
• Pyrazolo[1,5-A]Pyrimidin-5-Ol

pyrazolo[1,5-a]pyrimidin-5(4H)-one

CAS: 29274-22-4

Formula: C₆H₅N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 135.1234

Ref: IN-DA002XXO

4H,5H-Pyrazolo[1,5-a]pyrimidin-5-one

CAS: 29274-22-4

4H,5H-Pyrazolo[1,5-a]pyrimidin-5-one

Purity: 99%

Molecular weight: 135.12g/mol

Ref: 54-OR33560

5-Hydroxypyrazolo[1,5-a]pyrimidine

CAS: 29274-22-4

Formula: C₆H₅N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 135.043

Ref: 10-F223357