CAS 29274-28-0
:4-Chloro-1H-pyrazolo[3,4-b]pyridine
Description:
4-Chloro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound features a chlorine substituent at the 4-position of the pyrazole ring, influencing its reactivity and potential applications. It is typically a crystalline solid, exhibiting moderate solubility in polar organic solvents. The presence of both nitrogen atoms in the ring structure enhances its ability to participate in various chemical reactions, making it a valuable intermediate in organic synthesis and medicinal chemistry. Its structural framework allows for potential interactions with biological targets, which has led to interest in its pharmacological properties. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 4-Chloro-1H-pyrazolo[3,4-b]pyridine is notable for its versatility in chemical synthesis and potential applications in drug development.
Formula:C6H4ClN3
InChI:InChI=1/C6H4ClN3/c7-5-1-2-8-6-4(5)3-9-10-6/h1-3H,(H,8,9,10)
SMILES:c1cnc2c(cn[nH]2)c1Cl
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine, 4-chloro-
- 5-Chloro-2,8,9-Triazabicyclo[4.3.0]Nona-1,3,5,7-Tetraene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-1H-pyrazolo[3,4-b]pyridine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4ClN3Purity:98%Molecular weight:153.571H-Pyrazolo[3,4-b]pyridine, 4-chloro-
CAS:Formula:C6H4ClN3Purity:97%Color and Shape:SolidMolecular weight:153.5691Ref: IN-DA002XXK
1g40.00€5g85.00€10g124.00€25g193.00€50g498.00€100gTo inquire250gTo inquire100mg20.00€250mg25.00€4-Chloro-1H-pyrazolo[3,4-b]pyridine
CAS:4-Chloro-1H-pyrazolo[3,4-b]pyridineFormula:C6H4ClN3Purity:98%Color and Shape: beige solidMolecular weight:153.57g/mol4-Chloro-7-aza-1H-indazole
CAS:Formula:C6H4ClN3Purity:95.0%Color and Shape:SolidMolecular weight:153.009



