CAS 29279-66-1
:(2-methylidenecyclopropyl)methanol
Description:
(2-Methylidenecyclopropyl)methanol, with the CAS number 29279-66-1, is an organic compound characterized by its unique structure that includes a cyclopropyl ring and a methanol functional group. This compound features a double bond between the carbon atoms in the cyclopropyl moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl (-OH) group indicates that it can participate in hydrogen bonding, which may influence its solubility in polar solvents. Additionally, the methylidene group introduces a level of unsaturation, which can affect the compound's stability and reactivity. As with many organic compounds, its physical properties, such as boiling point, melting point, and density, are influenced by its molecular structure and functional groups. The compound may exhibit interesting chemical behavior, making it a subject of interest in synthetic organic chemistry and potentially in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C5H8O
InChI:InChI=1/C5H8O/c1-4-2-5(4)3-6/h5-6H,1-3H2
SMILES:C=C1CC1CO
Synonyms:- 2-Methylenecyclopropanemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclopropanemethanol, 2-methylene-
CAS:Formula:C5H8OPurity:98%Color and Shape:LiquidMolecular weight:84.1164(2-Methylenecyclopropyl)methanol
CAS:(2-Methylenecyclopropyl)methanolPurity:98%Molecular weight:84.12g/mol(2-Methylenecyclopropyl)methanol
CAS:2-Methylenecyclopropyl)methanol (2-MCPM) is a useful scaffold for the synthesis of complex compounds. It is a versatile building block that can be used as a reactive intermediate in chemical reactions, or as an intermediate for the synthesis of fine chemicals. 2-MCPM has been found to be an excellent solvent and can be used in reactions with metal ions.Formula:C5H8OPurity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:84.12 g/mol(2-Methylenecyclopropyl)methanol
CAS:Controlled ProductApplications (2-Methylenecyclopropyl)methanol is a chemical reagent used in the synthesis of biologically active compounds.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Mollendal, H. et al.: J. Phys. Chem., 110, 6054 (2006); Averina, E. et al.: Synth. 5, 880 (2006);Formula:C5H8OColor and Shape:NeatMolecular weight:84.12




