CAS 2929-07-9

2-[(9E)-octadec-9-en-1-yloxy]propane-1,3-diol

Description:

2-[(9E)-octadec-9-en-1-yloxy]propane-1,3-diol, with the CAS number 2929-07-9, is a chemical compound characterized by its structure, which includes a long-chain fatty alcohol moiety and a glycerol backbone. This compound features a double bond in the alkyl chain, specifically at the 9th carbon position, indicating it is an unsaturated fatty alcohol derivative. The presence of the propane-1,3-diol structure suggests that it has two hydroxyl (-OH) groups, which contribute to its hydrophilicity and potential for forming hydrogen bonds. This compound is likely to exhibit amphiphilic properties, making it useful in various applications such as emulsifiers, surfactants, or in the formulation of personal care products. Its long hydrophobic tail combined with the hydrophilic head can facilitate the solubilization of oils in water, enhancing the stability of emulsions. Additionally, the unsaturation in the fatty chain may influence its reactivity and interactions with other substances, potentially affecting its stability and shelf life in formulations.

Formula: C₂₁H₄₂O₃

InChI: InChI=1/C21H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-21(19-22)20-23/h9-10,21-23H,2-8,11-20H2,1H3/b10-9+

2-Oleoylglycerol ether 95%

CAS: 2929-07-9

Formula: C21H42O3

Purity: >95%

Color and Shape: Liquid

Molecular weight: 342.56

Ref: 48-31-1890

2-[(9Z)-9-Octadecenyloxy]-1,3-propanediol

Controlled Product

CAS: 2929-07-9

Applications 2-[(9Z)-9-Octadecenyloxy]-1,3-propanediol, which is an endogenous cannabinoid receptor ligand.
References Suhara, Y. et al.: Chem. Pharm. Bull., 48, 903 (2000);

Formula: C₂₁H₄₂O₃

Color and Shape: Neat

Molecular weight: 342.56

Ref: TR-O235930