CAS 2929-84-2

4-[(hydroxyimino)methyl]-N,N-dimethylaniline

Description:

4-[(Hydroxyimino)methyl]-N,N-dimethylaniline, with the CAS number 2929-84-2, is an organic compound characterized by its structure, which includes a dimethylaniline moiety and a hydroxyimino group. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in various fields, including dye synthesis and as an intermediate in organic synthesis. The presence of the hydroxyimino group imparts certain reactivity, making it useful in condensation reactions and as a ligand in coordination chemistry. Additionally, the dimethylamino groups contribute to its basicity and solubility in polar solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 4-[(hydroxyimino)methyl]-N,N-dimethylaniline is a versatile compound with notable chemical properties that facilitate its use in synthetic applications.

Formula: C₉H₁₂N₂O

InChI: InChI=1/C9H12N2O/c1-11(2)9-5-3-8(4-6-9)7-10-12/h3-7,12H,1-2H3

SMILES: CN(C)c1ccc(cc1)C=NO

4-(Dimethylamino)benzaldehyde oxime

CAS: 2929-84-2

Formula: C₉H₁₂N₂O

Molecular weight: 164.2044

Ref: IN-DA00C3IG

4-(N,N-Dimethylamino)benzaldoxime

CAS: 2929-84-2

4-(N,N-Dimethylamino)benzaldoxime is an efficient method for the detection of cinnamic acid and its esters. It reacts with aldehydes to form 4-nitrosobenzaldehyde products that are detectable by ultraviolet spectroscopy. The reaction takes place in aqueous solutions with a pH range of 5-8 and is catalyzed by an enzyme called carboxylate. This reaction has been shown to be useful for the detection of cinnamic acid and its esters in food, tobacco smoke, and other samples.

Formula: C₉H₁₂N₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 164.2 g/mol

Ref: 3D-FD66859