CAS 29295-80-5
:Mercaptopropyltrimethoxysilane homopolymer
Description:
Mercaptopropyltrimethoxysilane homopolymer, identified by CAS number 29295-80-5, is a silane coupling agent characterized by its unique chemical structure that includes mercapto (thiol) groups and trimethoxysilane functionalities. This compound typically exhibits excellent adhesion properties, making it valuable in various applications, particularly in the fields of coatings, adhesives, and sealants. The presence of mercapto groups imparts reactivity, allowing for cross-linking and bonding with various substrates, including metals, glass, and organic materials. Additionally, the trimethoxysilane moiety facilitates the formation of siloxane networks upon hydrolysis and condensation, enhancing the material's durability and resistance to environmental factors. The homopolymer nature of this substance suggests that it consists of repeating units derived from the mercaptopropyltrimethoxysilane, contributing to its mechanical strength and stability. Overall, this compound is recognized for its versatility and effectiveness in improving the performance of composite materials and surface treatments.
Formula:(C6H16O3SSi)x
InChI:InChI=1S/C6H16O3SSi/c1-7-11(8-2,9-3)6-4-5-10/h10H,4-6H2,1-3H3
InChI key:InChIKey=UUEWCQRISZBELL-UHFFFAOYSA-N
SMILES:[Si](CCCS)(OC)(OC)OC
Synonyms:- γ-Mercaptopropyltrimethoxysilane homopolymer
- 1-Propanethiol, 3-(trimethoxysilyl)-, polymers
- (3-Mercaptopropyl)trimethoxysilane homopolymer
- 1-Propanethiol, 3-(trimethoxysilyl)-, homopolymer
- Poly(γ-mercaptopropyltrimethoxysilane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
