CAS 29304-40-3
:ethyl 2-methyl-3-oxohexanoate
Description:
Ethyl 2-methyl-3-oxohexanoate, with the CAS number 29304-40-3, is an organic compound that belongs to the class of esters. It is characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, making it potentially useful in flavoring and fragrance applications. Its molecular structure features a six-carbon chain with a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. Ethyl 2-methyl-3-oxohexanoate is soluble in organic solvents, which enhances its utility in various chemical processes. Additionally, it may exhibit moderate volatility and can participate in various chemical reactions, including condensation and acylation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound is of interest in both industrial and research settings due to its unique structural features and potential applications.
Formula:C9H16O3
InChI:InChI=1/C9H16O3/c1-4-6-8(10)7(3)9(11)12-5-2/h7H,4-6H2,1-3H3
SMILES:CCCC(=O)C(C)C(=O)OCC
Synonyms:- Hexanoic acid, 2-methyl-3-oxo-, ethyl ester
- Ethyl 2-methyl-3-oxohexanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 2-methyl-3-oxohexanoate
CAS:<p>Ethyl 2-methyl-3-oxohexanoate is an ester with a chemical formula of C8H14O2. It is an acyclic compound and a member of the ethers family. It has the molecular weight of 132.17 g/mol and a density of 0.965 g/mL at 25°C. The melting point for this compound is -78°C and it has a boiling point of 164°F (73°C). Ethyl 2-methyl-3-oxohexanoate has been found to have high levels in Delphinium species, which are plants that contain alkaloids such as methyllycaconitine, which are analogues to the more well known morphine. This ester can be synthesized from the reaction between ethyl acetate and benzaldehyde.</p>Formula:C9H16O3Purity:Min. 95%Molecular weight:172.22 g/mol
