CAS 29307-03-7: Deoxyelephantopin
Description:Deoxyelephantopin is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant Elephantopus scaber, which is known for its traditional medicinal uses. This compound exhibits a range of biological activities, including anti-inflammatory, anti-cancer, and antimicrobial properties, making it of interest in pharmacological research. Deoxyelephantopin is characterized by its unique chemical structure, which includes a lactone ring and multiple chiral centers, contributing to its diverse biological effects. The compound has been studied for its potential therapeutic applications, particularly in the treatment of various diseases, including cancer and inflammatory conditions. Its mechanism of action often involves the modulation of signaling pathways and the induction of apoptosis in cancer cells. Additionally, deoxyelephantopin's safety profile and efficacy are subjects of ongoing research, as scientists explore its potential as a natural therapeutic agent. Overall, deoxyelephantopin represents a promising area of study within the field of natural products and medicinal chemistry.
Formula:C19H20O6
InChI:InChI=1/C19H20O6/c1-9(2)17(20)24-15-8-12-7-13(23-19(12)22)5-10(3)6-14-16(15)11(4)18(21)25-14/h6-7,13-16H,1,4-5,8H2,2-3H3/b10-6+/t13-,14-,15+,16+/m1/s1
InChI key:InChIKey=JMUOPRSXUVOHFE-MCYOVBASSA-N
SMILES:O=C(OC1CC2=CC(OC2=O)CC(=CC3OC(=O)C(=C)C31)C)C(=C)C
- Synonyms:
- 7H-9,6-Methenofuro[2,3-f]oxacycloundecin, 2-propenoic acid deriv.
- 2-Propenoic acid, 2-methyl-, 2,3,3a,4,5,9,10,12a-octahydro-11-methyl-3-methylene-2,7-dioxo-7H-9,6-methenofuro[2,3-f]oxacycloundecin-4-yl ester, [3aR-(3aR*,4S*,9R*,11E,12aR*)]-
- 2-Propenoic acid, 2-methyl-, (3aR,4S,9R,11E,12aR)-2,3,3a,4,5,9,10,12a-octahydro-11-methyl-3-methylene-2,7-dioxo-7H-9,6-methenofuro[2,3-f]oxacycloundecin-4-yl ester
- Methacrylic acid, 8-ester with 2β,6α,8α-trihydroxygermacra-1(10),4,11(13)-triene-12,14-dioic acid di-γ-lactone, (E)-
- Germacra-1(10),4,11(13)-triene-12,14-dioic acid, 2β,6α,8α-trihydroxy-, 12,6:14,2-dilactone, methacrylate, (E)-
