CAS 29315-53-5: Salicyl acyl glucuronide
Description:Salicyl acyl glucuronide is a chemical compound that serves as a metabolite of salicylic acid, a well-known nonsteroidal anti-inflammatory drug (NSAID). It is characterized by its glucuronide conjugate structure, which is formed through the process of glucuronidation, a common phase II metabolic reaction that enhances the solubility and excretion of various drugs. This compound typically exhibits a polar nature due to the presence of the glucuronic acid moiety, which facilitates its solubility in aqueous environments. Salicyl acyl glucuronide is primarily involved in the detoxification and elimination of salicylic acid from the body. Its formation is significant in pharmacokinetics, as it can influence the therapeutic effects and side effects of salicylic acid. Additionally, this metabolite may have its own biological activities, which can contribute to the overall pharmacological profile of salicylic acid. Understanding the characteristics and behavior of salicyl acyl glucuronide is essential for evaluating the safety and efficacy of salicylate-based therapies.
Formula:C13H14O9
InChI:InChI=1S/C13H14O9/c14-6-4-2-1-3-5(6)12(20)22-13-9(17)7(15)8(16)10(21-13)11(18)19/h1-4,7-10,13-17H,(H,18,19)/t7-,8-,9+,10-,13-/m0/s1
InChI key:InChIKey=IXVVXKRKCLJCKA-UNLLLRGISA-N
SMILES:O=C(O)C1OC(OC(=O)C=2C=CC=CC2O)C(O)C(O)C1O
- Synonyms:
- Glucopyranosiduronic acid, 1-salicylate, β-<span class="text-smallcaps">D</span>-
- Salicyl acyl glucuronide
- Salicylic acid glucuronide
- Salicylic acid, β-<span class="text-smallcaps">D</span>-glucopyranuronosyl ester
- beta-D-Glucopyranuronic acid, 1-(2-hydroxybenzoate)
- β-<span class="text-smallcaps">D</span>-Glucopyranuronic acid, 1-(2-hydroxybenzoate)
- Salicylic acid, β-D-glucopyranuronosyl ester
- Glucopyranosiduronic acid, 1-salicylate, β-D-
- β-D-Glucopyranuronic acid, 1-(2-hydroxybenzoate)
