CAS 2933-75-7

2-[(2-Methoxyphenyl)amino]ethanol

Description:

2-[(2-Methoxyphenyl)amino]ethanol, with the CAS number 2933-75-7, is an organic compound characterized by the presence of both an amino group and an alcohol functional group. This compound features a 2-methoxyphenyl group attached to an ethanol backbone, which contributes to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methoxy group enhances its solubility in organic solvents, while the amino and hydroxyl groups can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its structure allows for potential applications in various fields, including as a building block in organic synthesis or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₃NO₂

InChI: InChI=1S/C9H13NO2/c1-12-9-5-3-2-4-8(9)10-6-7-11/h2-5,10-11H,6-7H2,1H3

InChI key: InChIKey=CWDMDQXDGXFQFX-UHFFFAOYSA-N

SMILES: N(CCO)C1=C(OC)C=CC=C1

Synonyms:

• Ethanol, 2-o-anisidino-
• N-(β-Hydroxyethyl)-o-anisidine
• 2-[(2-Methoxyphenyl)amino]ethanol
• 2-(2-Methoxyphenylamino)ethanol
• Ethanol, 2-[(2-methoxyphenyl)amino]-

2-[(2-Methoxyphenyl)amino]ethan-1-ol

CAS: 2933-75-7

Versatile small molecule scaffold

Formula: C₉H₁₃NO₂

Purity: Min. 95%

Molecular weight: 167.2 g/mol

Ref: 3D-CAA93375