CAS 2935-32-2

Olean-12-ene-3,11-dione

Description:

Olean-12-ene-3,11-dione, with the CAS number 2935-32-2, is a triterpenoid compound that is part of the oleanane family, which is characterized by a specific arrangement of carbon atoms forming a tetracyclic structure. This compound features two ketone functional groups located at the 3 and 11 positions of the oleanene skeleton, contributing to its reactivity and potential biological activity. Olean-12-ene-3,11-dione is typically found in various plant species and is of interest in pharmacology due to its potential therapeutic properties, including anti-inflammatory and anticancer effects. The compound is generally characterized by its hydrophobic nature, which influences its solubility and interaction with biological membranes. Its structural features allow for various chemical modifications, making it a subject of interest in synthetic organic chemistry and natural product research. Overall, Olean-12-ene-3,11-dione exemplifies the complexity and diversity of natural compounds derived from plant sources.

Formula: C₃₀H₄₆O₂

InChI: InChI=1S/C30H46O2/c1-25(2)13-14-27(5)15-16-29(7)19(20(27)18-25)17-21(31)24-28(6)11-10-23(32)26(3,4)22(28)9-12-30(24,29)8/h17,20,22,24H,9-16,18H2,1-8H3/t20-,22-,24+,27+,28-,29+,30+/m0/s1

InChI key: InChIKey=XQIVDOSRZQSWFL-QKMNFNRLSA-N

SMILES: C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)CCC(C)(C)C4)[H])=CC(=O)[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)C(=O)CC5)[H])[H]

Synonyms:

• 12-Oleanen-3,11-dione
• 3,11-Dioxo-b-amyrene
• 3,11-Dioxoolean-12-ene
• Olean-12-ene-3,11-dione

Olean-12-ene-3,11-dione

CAS: 2935-32-2

Formula: C₃₀H₄₆O₂

Purity: 93.0%

Color and Shape: Solid

Molecular weight: 438.6850

Ref: IN-DA002Y4P

Olean-12-ene-3,11-dione

CAS: 2935-32-2

Olean-12-ene-3,11-dione is a natural product for research related to life sciences. The catalog number is TN4702 and the CAS number is 2935-32-2.

Formula: C₃₀H₄₆O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 438.69

Ref: TM-TN4702

Olean-12-ene-3,11-dione

CAS: 2935-32-2

Formula: C₃₀H₄₆O₂

Purity: 95%~99%

Molecular weight: 438.696

Ref: BP-SBP02216

Olean-12-ene-3,11-dione

Controlled Product

CAS: 2935-32-2

Olean-12-ene-3,11-dione is a pentacyclic triterpenoid compound, which is derived from natural sources such as the bark of various plants. This bioactive molecule exhibits a range of biological activities attributed to its unique structure. The mode of action involves the modulation of multiple biochemical pathways, influencing processes like inflammation, apoptosis, and cell proliferation. Through its interaction with cellular targets, it can inhibit pro-inflammatory mediators and promote apoptosis in pathological cells.

Formula: C₃₀H₄₆O₂

Purity: Min. 95%

Molecular weight: 438.7 g/mol

Ref: 3D-CAA93532