CAS 2935-63-9
:2-(2,3-Dimethylphenoxy)acetic acid
Description:
2-(2,3-Dimethylphenoxy)acetic acid, with the CAS number 2935-63-9, is an organic compound that belongs to the class of phenoxyacetic acids. It features a phenoxy group, which is a phenyl ring bonded to an ether oxygen, and an acetic acid moiety. This compound is characterized by its aromatic structure, which contributes to its chemical stability and potential reactivity. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited. The presence of the dimethyl substituents on the phenyl ring can influence its biological activity and interactions with other molecules. This compound is of interest in various fields, including agrochemicals, where it may function as a herbicide or plant growth regulator. Its specific applications and effects depend on its concentration and the environmental conditions under which it is used. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or environmental impact.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)
InChI key:InChIKey=AVDBMBYECMTQJQ-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(C)C(C)=CC=C1
Synonyms:- (2,3-Dimethylphenoxy)Acetate
- (2,3-Dimethylphenoxy)acetic acid
- 2,3-Xylyloxyacetic acid
- 2-(2,3-Dimethylphenoxy)acetic acid
- Acetic acid, (2,3-dimethylphenoxy)-
- Acetic acid, (2,3-xylyloxy)-
- Acetic acid, 2-(2,3-dimethylphenoxy)-
- NSC 62095
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-(2,3-dimethylphenoxy)-
CAS:Formula:C10H12O3Purity:98%Color and Shape:SolidMolecular weight:180.2005(2,3-Dimethylphenoxy)acetic acid
CAS:(2,3-Dimethylphenoxy)acetic acid
Purity:99%Color and Shape:Off-White PowderMolecular weight:180.20g/mol2,3-Dimethylphenoxyacetic acid
CAS:2,3-Dimethylphenoxyacetic acid is a selective inhibitor of strictosidine synthase, an enzyme that catalyzes the last step in the biosynthesis of the alkaloid strictosidine. It binds to a cysteine amino acid residue in the active site of the enzyme and prevents catalysis. This inhibition could be due to its ability to form covalent bonds with other molecules or its ability to bind strongly to metals such as iron and cobalt. 2,3-Dimethylphenoxyacetic acid has shown inhibitory effects on leukemia cells, HLA-60 human leukemia cells and HL-60 human leukemia cells. It is currently being investigated for use in cancer treatment.Formula:C10H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:180.2 g/mol



