CAS 29364-10-1
:methyl (1S,2R,3S,5R)-3-{[(2,6-dimethylphenyl)carbamoyl]oxy}-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate
Description:
Methyl (1S,2R,3S,5R)-3-{[(2,6-dimethylphenyl)carbamoyl]oxy}-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate, with CAS number 29364-10-1, is a complex organic compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, indicating it is a bicyclic amine. The presence of multiple chiral centers contributes to its stereochemistry, which is crucial for its biological activity. The compound features a carbamate functional group, as indicated by the carbamoyl moiety, and an ester group due to the carboxylate component. The dimethylphenyl substituent enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its structural complexity suggests potential applications in drug development, particularly in areas requiring selective binding or activity. Overall, the compound's unique features, including its stereochemistry and functional groups, are essential for understanding its chemical behavior and potential therapeutic uses.
Formula:C19H26N2O4
InChI:InChI=1/C19H26N2O4/c1-11-6-5-7-12(2)17(11)20-19(23)25-15-10-13-8-9-14(21(13)3)16(15)18(22)24-4/h5-7,13-16H,8-10H2,1-4H3,(H,20,23)/t13-,14+,15+,16-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1αH,5αH-Tropane-2β-carboxylic acid, 3β-hydroxy-, methyl ester, 2,6-dimethylcarbanilate (ester) (8CI)
CAS:Formula:C19H26N2O4Molecular weight:346.4207

