CAS 29366-77-6
:6-(2-Chlorophenyl)-1,3,5-triazine-2,4-diamine
Description:
6-(2-Chlorophenyl)-1,3,5-triazine-2,4-diamine, with the CAS number 29366-77-6, is an organic compound characterized by its triazine ring structure, which is a six-membered aromatic heterocycle containing three nitrogen atoms. This compound features two amino groups (-NH2) at the 2 and 4 positions of the triazine ring, contributing to its potential reactivity and solubility in polar solvents. The presence of a 2-chlorophenyl substituent at the 6-position enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The triazine moiety is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the chlorophenyl group can impart specific electronic properties, making this compound of interest in the development of dyes, herbicides, or other functional materials. Overall, its unique structural features suggest a diverse range of potential applications in chemical research and industry.
Formula:C9H8ClN5
InChI:InChI=1/C9H8ClN5/c10-6-4-2-1-3-5(6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15)
InChI key:InChIKey=RDRNLYCDZBVQKZ-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC=C1)C=2N=C(N)N=C(N)N2
Synonyms:- 1,3,5-Triazine-2,4-diamine, 6-(2-chlorophenyl)-
- Ai3-62829
- NSC 121171
- o-Chlorobenzoguanamine
- s-Triazine, 2,4-diamino-6-(o-chlorophenyl)-
- 6-(2-Chlorophenyl)-1,3,5-triazine-2,4-diamine
- 2,4-Diamino-6-(2-chlorophenyl)-1,3,5-triazine
- Irsogladine Impurity
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
