CAS 293737-84-5

2-(2,5-Dichlorophenyl)-5-benzoxazolamine

Description:

2-(2,5-Dichlorophenyl)-5-benzoxazolamine is a chemical compound characterized by its unique structure, which includes a benzoxazole moiety and a dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the benzoxazole ring, which is known for its role in various pharmacological applications. The dichlorophenyl substituent may influence the compound's lipophilicity and reactivity, potentially enhancing its interaction with biological targets. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific functional groups present. Additionally, the presence of chlorine atoms can impart unique electronic properties, affecting the compound's stability and reactivity. Overall, 2-(2,5-Dichlorophenyl)-5-benzoxazolamine is of interest in medicinal chemistry and materials science, warranting further investigation into its potential applications and mechanisms of action.

Formula: C₁₃H₈Cl₂N₂O

InChI: InChI=1S/C13H8Cl2N2O/c14-7-1-3-10(15)9(5-7)13-17-11-6-8(16)2-4-12(11)18-13/h1-6H,16H2

InChI key: InChIKey=CEBMGSOURCAPDC-UHFFFAOYSA-N

SMILES: ClC1=C(C=2OC=3C(N2)=CC(N)=CC3)C=C(Cl)C=C1

Synonyms:

• 2-(2,5-Dichlorophenyl)-1,3-benzoxazol-5-amine
• 2-(2,5-Dichloro-phenyl)-benzooxazol-5-ylamine
• 2-(2,5-Dichlorophenyl)-5-benzoxazolamine
• 5-Benzoxazolamine, 2-(2,5-dichlorophenyl)-

2-(2,5-Dichlorophenyl)benzo[D]oxazol-5-amine

CAS: 293737-84-5

Please enquire for more information about 2-(2,5-Dichlorophenyl)benzo[D]oxazol-5-amine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₈Cl₂N₂O

Purity: Min. 95%

Molecular weight: 279.12 g/mol

Ref: 3D-TLA73784