
CAS 293737-99-2
:2-(1-Naphthalenyl)-2H-benzotriazol-5-amine
Description:
2-(1-Naphthalenyl)-2H-benzotriazol-5-amine, identified by its CAS number 293737-99-2, is an organic compound characterized by its complex structure that includes a naphthalene moiety and a benzotriazole ring. This compound typically exhibits properties such as good thermal stability and solubility in organic solvents, making it suitable for various applications in materials science and organic synthesis. The presence of the amine functional group suggests potential reactivity, allowing for further chemical modifications. Additionally, benzotriazole derivatives are known for their UV-absorbing properties, which can be advantageous in applications such as photostabilizers in plastics and coatings. The compound may also exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Overall, its unique structural features and functional groups contribute to its versatility in both industrial and research settings.
Formula:C16H12N4
InChI:InChI=1S/C16H12N4/c17-12-8-9-14-15(10-12)19-20(18-14)16-7-3-5-11-4-1-2-6-13(11)16/h1-10H,17H2
InChI key:InChIKey=YMGWUQOUHMKTFE-UHFFFAOYSA-N
SMILES:NC1=CC2=NN(N=C2C=C1)C=3C4=C(C=CC3)C=CC=C4
Synonyms:- 2-(1-Naphthalenyl)-2H-benzotriazol-5-amine
- 2H-Benzotriazol-5-amine, 2-(1-naphthalenyl)-
- 2-(Naphthalen-1-yl)-2H-benzo[d][1,2,3]triazol-5-amine
- 2-Naphthalen-1-yl-2H-benzotriazol-5-ylamine
- 2-Naphthalen-1-ylbenzotriazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.