CAS 29375-30-2
:tert-butyl L-alanyl-L-prolinate
Description:
Tert-butyl L-alanyl-L-prolinate, with the CAS number 29375-30-2, is an organic compound that belongs to the class of amino acid derivatives. It features a tert-butyl group, which contributes to its hydrophobic characteristics, and is derived from the amino acids L-alanine and L-proline. This compound is typically characterized by its relatively low solubility in water due to the bulky tert-butyl group, while it may exhibit better solubility in organic solvents. The presence of the amino acid moieties suggests potential applications in peptide synthesis and as a building block in medicinal chemistry. Additionally, the compound may exhibit specific stereochemical properties due to the chiral centers present in the L-alanine and L-proline components, which can influence its biological activity and interactions. Overall, tert-butyl L-alanyl-L-prolinate is of interest in various fields, including pharmaceuticals and biochemistry, due to its structural features and potential reactivity.
Formula:C12H22N2O3
InChI:InChI=1/C12H22N2O3/c1-8(13)10(15)14-7-5-6-9(14)11(16)17-12(2,3)4/h8-9H,5-7,13H2,1-4H3/t8-,9-/m0/s1
SMILES:C[C@@H](C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Proline, L-alanyl-, 1,1-dimethylethyl ester
CAS:Formula:C12H22N2O3Color and Shape:SolidMolecular weight:242.3147L-Alanyl-L-proline tert-butyl ester
CAS:<p>L-Alanyl-L-proline tert-butyl ester (LAP) is a potent inhibitor of proteases, including angiotensin converting enzyme (ACE), and can be used as an antihypertensive drug. LAP binds to the active site of the ACE and blocks the conversion of angiotensin I to angiotensin II. This inhibition leads to a reduction in blood pressure. LAP has been shown to inhibit the activity of other proteases such as cathepsins, chymotrypsin, trypsin, elastase, and papain. LAP also has potential for use as an anticancer agent due to its ability to inhibit cancer cell growth by blocking protein synthesis at the ribosome level.</p>Formula:C12H22N2O3Purity:Min. 95%Molecular weight:242.31 g/mol


