CAS 2938-69-4
:4-Ethyl-4-formylhexanenitrile
Description:
4-Ethyl-4-formylhexanenitrile, with the CAS number 2938-69-4, is an organic compound characterized by its unique functional groups and structure. It features a hexane backbone with an ethyl group and a formyl group (aldehyde) at the fourth carbon position, along with a nitrile group (–C≡N) also attached to the same carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the aldehyde and nitrile functional groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Safety data sheets should be consulted for handling and storage guidelines, as compounds containing nitriles can be toxic and require appropriate safety measures. Overall, 4-Ethyl-4-formylhexanenitrile is a versatile compound in organic chemistry with potential utility in various chemical processes.
Formula:C9H15NO
InChI:InChI=1S/C9H15NO/c1-3-9(4-2,8-11)6-5-7-10/h8H,3-6H2,1-2H3
InChI key:InChIKey=AMUXIQHQXOKMTN-UHFFFAOYSA-N
SMILES:C(CCC#N)(CC)(CC)C=O
Synonyms:- 4-Cyano-2,2-diethylbutanal
- Ai3-05926
- Butyraldehyde, 4-cyano-2,2-diethyl-
- Butyraldehyde, γ-cyano-α,α-diethyl-
- Glutaraldehydonitrile, 4,4-diethyl-
- Hexanenitrile, 4-ethyl-4-formyl-
- NSC 69068
- 4-Ethyl-4-formylhexanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
