
CAS 2939-66-4
:10,11-Dihydro-5-[3-(methylamino)propyl]-5H-dibenzo[a,d]cyclohepten-5-ol
Description:
10,11-Dihydro-5-[3-(methylamino)propyl]-5H-dibenzo[a,d]cyclohepten-5-ol, with CAS number 2939-66-4, is a chemical compound that belongs to the class of dibenzo[a,d]cycloheptenes. This substance features a complex polycyclic structure characterized by a fused bicyclic system, which contributes to its unique chemical properties. The presence of a hydroxyl group (-OH) indicates that it is an alcohol, which can influence its solubility and reactivity. Additionally, the methylamino group (-NH(CH3)2) suggests potential for biological activity, as amines often participate in various biochemical interactions. The compound's structure may allow for interactions with neurotransmitter systems, making it of interest in pharmacological research. Its molecular configuration can affect its stability, reactivity, and potential applications in medicinal chemistry. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Safety and handling precautions should be observed due to the potential biological activity of the compound.
Formula:C19H23NO
InChI:InChI=1S/C19H23NO/c1-20-14-6-13-19(21)17-9-4-2-7-15(17)11-12-16-8-3-5-10-18(16)19/h2-5,7-10,20-21H,6,11-14H2,1H3
InChI key:InChIKey=VGYXEZXCFKVWAP-UHFFFAOYSA-N
SMILES:C(CCNC)C1(O)C=2C(CCC=3C1=CC=CC3)=CC=CC2
Synonyms:- 5H-Dibenzo[a,d]cyclohepten-5-ol, 10,11-dihydro-5-[3-(methylamino)propyl]-
- 10,11-Dihydro-5-[3-(methylamino)propyl]-5H-dibenzo[a,d]cyclohepten-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5H-Dibenzo[a,d]cyclohepten-5-ol, 10,11-dihydro-5-[3-(methylamino)propyl]-
CAS:Formula:C19H23NOMolecular weight:281.392


