CAS 29399-02-8
:N~2~-acetyl-N,N,N~2~-trimethylglycinamide
Description:
N~2~-acetyl-N,N,N~2~-trimethylglycinamide, with the CAS number 29399-02-8, is a chemical compound that belongs to the class of amides. It is characterized by the presence of an acetyl group and three methyl groups attached to the nitrogen atoms of the glycine derivative. This structure contributes to its solubility in polar solvents and its potential biological activity. The compound may exhibit properties typical of amides, such as being relatively stable under standard conditions and having a moderate boiling point. Its functional groups suggest potential applications in pharmaceuticals or biochemistry, particularly in studies related to neurotransmitter activity or metabolic pathways. The presence of multiple methyl groups can influence its steric properties and reactivity, making it an interesting subject for further research in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be reviewed prior to use, as the specific biological effects and toxicity profiles would depend on the context of its application.
Formula:C7H14N2O2
InChI:InChI=1/C7H14N2O2/c1-6(10)9(4)5-7(11)8(2)3/h5H2,1-4H3
SMILES:CC(=O)N(C)CC(=O)N(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N,N-Dimethyl-2-(N-methylacetamido)acetamide
CAS:<p>N,N-Dimethyl-2-(N-methylacetamido)acetamide is an amide compound that is used as a solvent. It has a molecular weight of 143.16 and boiling point of 209 °C. This compound has been experimentally shown to have n-terminal kinetic stabilization and orbital interaction with the acceptor molecule. N,N-Dimethyl-2-(N-methylacetamido)acetamide is also underivatized, meaning it does not contain any functional groups for further chemical reactions. The conformational stability of this compound is dependent on the carbonyl oxygen at the c-terminus in addition to its electron affinities.</p>Formula:C7H14N2O2Purity:Min. 95%Molecular weight:158.2 g/mol
