CAS 2941-58-4
:Benzothiazole, 2-bromo-6-methoxy-
Description:
Benzothiazole, 2-bromo-6-methoxy- is an organic compound characterized by its fused benzene and thiazole rings, which contribute to its aromatic properties. The presence of a bromine atom at the 2-position and a methoxy group at the 6-position of the benzothiazole structure enhances its reactivity and solubility in organic solvents. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in pharmaceuticals, agrochemicals, and as a dye intermediate. Its molecular structure allows for various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis. Additionally, benzothiazole derivatives are often studied for their biological activities, including antimicrobial and antifungal properties. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, benzothiazole, 2-bromo-6-methoxy- is a significant compound in both industrial and research settings.
Formula:C8H6BrNOS
InChI:InChI=1/C8H6BrNOS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3
SMILES:COc1ccc2c(c1)sc(Br)n2
Synonyms:- 2-Bromo-6-methoxy-1,3-benzothiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzothiazole, 2-bromo-6-methoxy-
CAS:Formula:C8H6BrNOSPurity:98%Color and Shape:SolidMolecular weight:244.10832-Bromo-6-methoxybenzo[d]thiazole
CAS:2-Bromo-6-methoxybenzo[d]thiazolePurity:98%Molecular weight:244.10833g/mol2-Bromo-6-methoxybenzothiazole
CAS:Formula:C8H6BrNOSPurity:98%Color and Shape:SolidMolecular weight:244.112-Bromo-6-methoxy-1,3-benzothiazole
CAS:Controlled ProductApplications 2-Bromo-6-methoxy-1,3-benzothiazole
Formula:C8H6BrNOSColor and Shape:NeatMolecular weight:244.1082-Bromo-6-methoxybenzothiazole
CAS:2-Bromo-6-methoxybenzothiazole is a high quality chemical reagent that is used as an intermediate in the synthesis of other compounds. It has been shown to be a useful scaffold and building block for the synthesis of complex compounds, such as 2-aminobenzothiazoles, which are useful for research chemicals and fine chemicals. This compound can also be used as a reaction component for the synthesis of diverse compounds.
Formula:C8H6BrNOSPurity:Min. 95 Area-%Molecular weight:244.12 g/molRef: 3D-B-8920
Discontinued product




