CAS 29410-13-7
:5-Hydroxyhydantoin
Description:
5-Hydroxyhydantoin is a chemical compound characterized by its unique structure, which includes a hydantoin ring with a hydroxyl group at the 5-position. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It is known for its potential use in pharmaceuticals and as an intermediate in organic synthesis. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution and condensation. Additionally, 5-Hydroxyhydantoin can exhibit biological activity, which may be of interest in medicinal chemistry. Its stability under standard conditions is generally good, although it may be sensitive to extreme pH levels or high temperatures. Overall, 5-Hydroxyhydantoin is a compound of interest in both research and industrial applications due to its functional properties and potential utility in developing new materials or therapeutic agents.
Formula:C3H4N2O3
InChI:InChI=1S/C3H4N2O3/c6-1-2(7)5-3(8)4-1/h1,6H,(H2,4,5,7,8)
InChI key:InChIKey=WYLUZALOENCNQU-UHFFFAOYSA-N
SMILES:OC1C(=O)NC(=O)N1
Synonyms:- 2,4-Imidazolidinedione, 5-hydroxy-
- 5-Hydroxy-2,4-imidazolidinedione
- 5-Hydroxyimidazolidine-2,4-Dione
- Hydantoin, 5-hydroxy-
- 5-Hydroxyhydantoin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-Hydroxyhydantoin
CAS:Controlled ProductApplications 5-Hydroxyhydantoin (cas# 29410-13-7) is a compound useful in organic synthesis.
Formula:C3H4N2O3Color and Shape:WhiteMolecular weight:116.08

