CAS 29412-62-2
:dimethyl cubane-1,4-dicarboxylate
Description:
Dimethyl cubane-1,4-dicarboxylate is an organic compound characterized by its unique cubane structure, which consists of a saturated hydrocarbon framework with four carboxylate groups at the 1 and 4 positions, each esterified with a methyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its relatively high stability due to the rigidity of the cubane structure, which can influence its reactivity and interactions with other molecules. Dimethyl cubane-1,4-dicarboxylate is often utilized in organic synthesis and as a building block in the development of various chemical compounds, including pharmaceuticals and agrochemicals. Its properties, such as solubility and boiling point, can vary based on the presence of functional groups and the overall molecular structure. Additionally, it may exhibit interesting physical and chemical properties, making it a subject of study in materials science and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H12O4
InChI:InChI=1/C12H12O4/c1-15-9(13)11-3-6-4(11)8-5(11)7(3)12(6,8)10(14)16-2/h3-8H,1-2H3
SMILES:COC(=O)C12C3C4C1C1C2C3C41C(=O)OC
Synonyms:- Dimethyl 1,4-Cubanedicarboxylate
- 1,4-Cubanedicarboxylic Acid Dimethyl*Ester
- Dimethyl Pentacyclo[4.2.0.0~2,5~.0~3,8~.0~4,7~]Octane-1,4-Dicarboxylate
- dimethyl(1s,2R,5s,6S)-cubane-1,4-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylic acid, 1,4-dimethyl ester
CAS:Formula:C12H12O4Purity:95%Color and Shape:SolidMolecular weight:220.2213Ref: IN-DA002YAO
25gTo inquire100mg30.00€250mg56.00€1g113.00€5g351.00€10g564.00€50g2,082.00€100g4,043.00€250g8,080.00€Dimethyl (1R,2R,3S,4S,5S,6R,8S)-cubane-1,4-dicarboxylate
CAS:Dimethyl (1R,2R,3S,4S,5S,6R,8S)-cubane-1,4-dicarboxylateFormula:C12H12O4Purity:98%Color and Shape:White SolidMolecular weight:220.22128Dimethyl 1,4-cubanedicarboxylate
CAS:Formula:C12H12O4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:220.221Dimethyl Cubane-1,4-dicarboxylate
CAS:Formula:C12H12O4Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:220.22Dimethyl 1,4-cubanedicarboxylate
CAS:Dimethyl 1,4-cubanedicarboxylate is a synthetic compound that belongs to the group of carbonyl compounds. It is a fluorinated derivative of 1,4-butanediol and has been synthesized in order to study its biological properties. Dimethyl 1,4-cubanedicarboxylate has been shown to antagonize the growth of a number of bacterial strains and to inhibit the enzyme acetylcholinesterase. The synthesis of this compound was achieved through the reaction mechanism involving an amine and a diacid. Dimethyl 1,4-cubanedicarboxylate also reacts with nucleophiles such as hydroxide ions or amines to form a new molecule with an electron-deficient carbonyl group (-CO).
Formula:C12H12O4Purity:Min. 95%Molecular weight:220.22 g/molDimethyl 1,4-Cubanedicarboxylate
CAS:Dimethyl 1,4-cubanedicarboxylate is a building block that is used as a reactant in organic synthesis. It can be used to synthesize various compounds, such as pharmaceuticals and dyes.Formula:C12H12O4Molecular weight:220.22 g/mol





