CAS 29415-97-2
:Methyl 3-bromo-4-hydroxybenzoate
Description:
Methyl 3-bromo-4-hydroxybenzoate, with the CAS number 29415-97-2, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, specifically characterized by a bromine atom at the 3-position and a hydroxyl group at the 4-position of the aromatic ring. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. Methyl 3-bromo-4-hydroxybenzoate exhibits various chemical properties, including the potential for electrophilic substitution reactions due to the presence of the bromine atom, which can influence the reactivity of the aromatic ring. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting its physical properties and reactivity. This compound may be of interest in pharmaceutical and chemical research due to its potential applications in synthesis and as a building block for more complex molecules.
Formula:C8H7BrO3
InChI:InChI=1/C8H7BrO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3
SMILES:COC(=O)c1ccc(c(c1)Br)O
Synonyms:- Benzoic Acid, 3-Bromo-4-Hydroxy-, Methyl Ester
- Methyl 3-bromo-4-hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 3-bromo-4-hydroxybenzoate, 98%
CAS:A reactant used in the preparation of selective inhibitors. In unsymmetrical Ullman reaction between methyl 5bromovanillate (II) and methyl 3-bromo-4-hydroxybenzoate (III) yielded all the three possible dicarbomethoxy-dibenzo-pdioxms which were separated by repeated chromatography over silica gel.Formula:C8H7BrO3Purity:98%Color and Shape:White, PowderMolecular weight:231.05Benzoic acid, 3-bromo-4-hydroxy-, methyl ester
CAS:Formula:C8H7BrO3Purity:97%Color and Shape:SolidMolecular weight:231.0434Ref: IN-DA002YAE
1g22.00€5g26.00€10g27.00€1kg501.00€25g47.00€5kgTo inquire100g101.00€250g196.00€500g278.00€Methyl 3-bromo-4-hydroxybenzoate
CAS:Methyl 3-bromo-4-hydroxybenzoateFormula:C8H7BrO3Purity:98%Color and Shape: white solidMolecular weight:231.04g/molMethyl 3-bromo-4-hydroxybenzoate
CAS:Controlled ProductApplications Methyl 3-bromo-4-hydroxybenzoate
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C8H7BrO3Color and Shape:NeatMolecular weight:231.04Methyl 3-bromo-4-hydroxybenzoate
CAS:Formula:C8H7BrO3Purity:97%Color and Shape:SolidMolecular weight:231.045Methyl-3-bromo-4-hydroxybenzoate
CAS:Methyl-3-bromo-4-hydroxybenzoate is an organic compound with the chemical formula CHBrO. It is a bifunctional molecule that is used in asymmetric synthesis as a chiral auxiliary. In the reaction, Methyl-3-bromo-4-hydroxybenzoate reacts with an aldehyde to produce a diastereomeric mixture of benzaldehydes. The resulting mixture can be separated by fractional crystallization, yielding pure products for further use in synthesis. X-ray crystallographic studies have shown that this molecule has a centroid at C1 and C2, and functional groups at C3 and C4.
Purity:Min. 95%Color and Shape:PowderMolecular weight:231.04 g/mol





