CAS 29416-86-2
:2-Aminoperimidine hydrochloride
Description:
2-Aminoperimidine hydrochloride is a chemical compound characterized by its perimidine structure, which features a bicyclic aromatic system. It contains an amino group (-NH2) that contributes to its basicity and potential reactivity in various chemical reactions. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for various functional group modifications, making it versatile in synthetic chemistry. Additionally, 2-Aminoperimidine hydrochloride may exhibit biological activity, which can be explored for potential applications in medicinal chemistry. As with many chemical substances, proper safety precautions should be taken when handling it, including the use of personal protective equipment and adherence to relevant safety guidelines.
Formula:C11H10ClN3
InChI:InChI=1/C11H9N3.ClH/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;/h1-6H,(H3,12,13,14);1H
SMILES:c1cc2cccc3c2c(c1)[nH]c(=N)[nH]3.Cl
Synonyms:- 1H-perimidin-2-amine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Perimidin-2-amine hydrochloride
CAS:Formula:C11H10ClN3Purity:97%Color and Shape:SolidMolecular weight:219.67022-Aminoperimidine hydrochloride
CAS:2-Aminoperimidine hydrochloride is the hydrochloride salt of 2-aminoperimidine, a polycyclic aromatic heterocycle featuring a fused naphthalene–pyrimidine ring system with an amino group at the 2-position. The protonated amino group forms a stable crystalline salt with hydrochloric acid, enhancing aqueous solubility and facilitating handling in laboratory applications.Formula:C11H9N3•(HCl)xPurity:Min. 95%Color and Shape:PowderMolecular weight:219.67 g/mol
