CAS 294179-26-3

2,6-Dimethylimidazo[2,1-b]-1,3,4-thiadiazole-5-methanol

Description:

2,6-Dimethylimidazo[2,1-b]-1,3,4-thiadiazole-5-methanol is a heterocyclic compound characterized by its unique structure, which includes an imidazole ring fused with a thiadiazole moiety. This compound features two methyl groups at the 2 and 6 positions of the imidazole ring, contributing to its chemical properties and reactivity. The presence of a hydroxymethyl group at the 5-position enhances its potential for various chemical interactions, making it a subject of interest in medicinal chemistry and material science. The compound is likely to exhibit moderate solubility in polar solvents due to the hydroxymethyl group, while its heterocyclic nature may impart specific biological activities. Additionally, the presence of sulfur in the thiadiazole ring can influence its electronic properties and reactivity. Overall, 2,6-Dimethylimidazo[2,1-b]-1,3,4-thiadiazole-5-methanol is a versatile compound with potential applications in pharmaceuticals and agrochemicals, warranting further investigation into its biological and chemical behavior.

Formula: C₇H₉N₃OS

InChI: InChI=1S/C7H9N3OS/c1-4-6(3-11)10-7(8-4)12-5(2)9-10/h11H,3H2,1-2H3

InChI key: InChIKey=VNYHIHBIXIMCMN-UHFFFAOYSA-N

SMILES: C(O)C=1N2C(=NC1C)SC(C)=N2

Synonyms:

• 2,6-Dimethylimidazo[2,1-b]-1,3,4-thiadiazole-5-methanol
• [Dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methanol
• Imidazo[2,1-b]-1,3,4-thiadiazole-5-methanol, 2,6-dimethyl-

{Dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl}methanol

CAS: 294179-26-3

Dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl}methanol (DMTMT) is a chemical compound that has been shown to have antiulcer properties. It also has antisecretory effects on the glands of the stomach and intestines. DMTMT may be used in the treatment of various diseases such as acute and chronic gastritis, peptic ulcers, and inflammation of the lining of the stomach.

Formula: C₇H₉N₃OS

Purity: Min. 95%

Molecular weight: 183.23 g/mol

Ref: 3D-ULA17926