CAS 2944-27-6
:1,5-Bis(phenylamino)-9,10-anthracenedione
Description:
1,5-Bis(phenylamino)-9,10-anthracenedione, with the CAS number 2944-27-6, is an organic compound characterized by its anthraquinone structure, which features two phenylamino groups attached to the 1 and 5 positions of the anthracenedione core. This compound typically exhibits a deep red to purple color, indicative of its conjugated system, which allows for strong light absorption and potential applications in dyes and pigments. It is known for its stability and can participate in various chemical reactions, including oxidation and reduction processes. The presence of the amino groups enhances its solubility in organic solvents and may facilitate interactions with biological systems, making it of interest in fields such as organic electronics and medicinal chemistry. Additionally, its photophysical properties, including fluorescence and phosphorescence, can be exploited in optoelectronic devices. Safety data should be consulted, as with many organic compounds, to understand its handling and potential toxicity.
Formula:C26H18N2O2
InChI:InChI=1S/C26H18N2O2/c29-25-20-14-8-16-22(28-18-11-5-2-6-12-18)24(20)26(30)19-13-7-15-21(23(19)25)27-17-9-3-1-4-10-17/h1-16,27-28H
InChI key:InChIKey=VMDUEJVMKSOQEZ-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=CC=CC3NC4=CC=CC=C4)=CC=C1)C5=CC=CC=C5
Synonyms:- 1,5-Dianilinoanthraquinone
- 1,5-Bis(phenylamino)-9,10-anthracenedione
- 9,10-Anthracenedione, 1,5-bis(phenylamino)-
- Anthraquinone, 1,5-dianilino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
