CAS 29443-41-2
:Benzeneacetaldehyde hydrazone
Description:
Benzeneacetaldehyde hydrazone, with the CAS number 29443-41-2, is an organic compound characterized by the presence of a hydrazone functional group derived from benzeneacetaldehyde and hydrazine. This compound typically appears as a crystalline solid and is known for its distinct aromatic properties due to the benzene ring. It is generally soluble in organic solvents, such as ethanol and ether, but may have limited solubility in water. Benzeneacetaldehyde hydrazone can participate in various chemical reactions, including condensation and oxidation, making it useful in synthetic organic chemistry. Its hydrazone structure allows for potential applications in the development of pharmaceuticals and agrochemicals, as well as in the study of reaction mechanisms involving hydrazones. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage in laboratory settings.
Formula:C8H10N2
InChI:InChI=1S/C8H10N2/c9-10-7-6-8-4-2-1-3-5-8/h1-5,7H,6,9H2
InChI key:InChIKey=RUZSWLOEFLRSGJ-UHFFFAOYSA-N
SMILES:C(C=NN)C1=CC=CC=C1
Synonyms:- Phenethylidenehydrazine
- Benzeneacetaldehyde, hydrazone
- Benzeneacetaldehyde hydrazone
- Phenylethylidenehydrazine
- Acetaldehyde, phenyl-, hydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
