CAS 2945-88-2
:4-(5,7-dihydroxy-4-oxo-4H-chromen-3-yl)phenyl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside
Description:
The chemical substance known as "4-(5,7-dihydroxy-4-oxo-4H-chromen-3-yl)phenyl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside," with the CAS number 2945-88-2, is a glycoside that features a flavonoid moiety and a sugar component. The structure includes a chromone derivative, which contributes to its potential biological activities, such as antioxidant and anti-inflammatory properties. The presence of hydroxyl groups enhances its reactivity and solubility in polar solvents. The glycosidic linkage to a sugar unit, specifically a deoxy-mannopyranosyl group, suggests that this compound may exhibit unique pharmacological effects, potentially influencing its bioavailability and interaction with biological systems. Such compounds are often studied for their therapeutic potential in various diseases, including cancer and cardiovascular disorders. Additionally, the specific stereochemistry and functional groups present in this molecule may play a crucial role in its biological activity and mechanism of action. Overall, this compound represents a complex interaction between flavonoid chemistry and carbohydrate structures, making it a subject of interest in medicinal chemistry and natural product research.
Formula:C27H30O14
InChI:InChI=1/C27H30O14/c1-10-19(31)22(34)24(36)26(38-10)41-25-23(35)21(33)17(8-28)40-27(25)39-13-4-2-11(3-5-13)14-9-37-16-7-12(29)6-15(30)18(16)20(14)32/h2-7,9-10,17,19,21-31,33-36H,8H2,1H3/t10-,17+,19-,21+,22+,23-,24+,25+,26-,27+/m0/s1
Synonyms:- 2945-88-2
- Genistein-4'-glucosidorhamnoside
- Sophorabioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Sophorabioside
CAS:<p>Sophorabioside is a flavonoid glycoside from Sophora japonica with anti-inflammatory, anticancer, and anti-osteoporotic activities for experimental research.</p>Formula:C27H30O14Purity:99.86%Color and Shape:SolidMolecular weight:578.52Sophorabioside
CAS:<p>Sophorabioside is a natural flavonoid glycoside, which is derived from the plant species belonging to the Sophora genus. This compound is primarily sourced from Sophora japonica, commonly known as the Japanese pagoda tree. Sophorabioside involves interactions at the molecular level that exhibit antioxidant and anti-inflammatory properties, contributing to its potential therapeutic benefits.</p>Formula:C27H30O14Purity:Min. 95%Molecular weight:578.52 g/mol



