CAS 29452-57-1

4-Amino-3-pyridinesulfonic acid monohydrate

Description:

4-Amino-3-pyridinesulfonic acid monohydrate is an organic compound characterized by its pyridine ring structure, which is substituted with an amino group and a sulfonic acid group. This compound is typically a white to off-white crystalline solid that is soluble in water due to the presence of the sulfonic acid group, which enhances its hydrophilicity. The presence of the amino group allows for potential interactions with other molecules, making it useful in various chemical reactions and applications. It is often utilized in biochemical research and as a reagent in organic synthesis. The monohydrate form indicates that it contains one molecule of water per molecule of the compound, which can influence its stability and solubility. As with many sulfonic acids, it exhibits acidic properties, contributing to its reactivity in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₆N₂O₃S

InChI: InChI=1/C5H6N2O3S/c6-4-1-2-7-3-5(4)11(8,9)10/h1-3H,(H2,6,7)(H,8,9,10)

SMILES: c1c[nH]cc(c1=N)S(=O)(=O)O

Synonyms:

• 3-Pyridinesulfonic Acid, 4-Amino-
• 4-Aminopyridine-3-sulfonic acid

4-Aminopyridine-3-sulfonic acid

CAS: 29452-57-1

Formula: C₅H₆N₂O₃S

Molecular weight: 174.1777

Ref: IN-DA002YF7

4-Aminopyridin-3-ylsulphonic acid

CAS: 29452-57-1

4-Aminopyridin-3-ylsulphonic acid

Purity: ≥95%

Molecular weight: 174.18g/mol

Ref: 54-OR2024