CAS 294620-60-3
:4-(2-methyl-1,3-thiazol-4-yl)benzoic acid
Description:
4-(2-Methyl-1,3-thiazol-4-yl)benzoic acid, identified by its CAS number 294620-60-3, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a thiazole ring. This compound features a thiazole group, which is a five-membered heterocyclic ring containing sulfur and nitrogen, contributing to its unique chemical properties. The methyl group on the thiazole enhances its lipophilicity, potentially influencing its solubility and reactivity. The carboxylic acid functional group (-COOH) in benzoic acid provides acidic properties, allowing for hydrogen bonding and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of both aromatic and heterocyclic components may influence its electronic properties and reactivity in various chemical reactions. Overall, 4-(2-methyl-1,3-thiazol-4-yl)benzoic acid is a compound of interest due to its unique structural characteristics and potential applications.
Formula:C11H9NO2S
InChI:InChI=1/C11H9NO2S/c1-7-12-10(6-15-7)8-2-4-9(5-3-8)11(13)14/h2-6H,1H3,(H,13,14)
SMILES:Cc1nc(cs1)c1ccc(cc1)C(=O)O
Synonyms:- Benzoic acid, 4-(2-methyl-4-thiazolyl)-
- 4-(2-Methyl-1,3-thiazol-4-yl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-(2-methyl-4-thiazolyl)-
CAS:Formula:C11H9NO2SPurity:95%Color and Shape:SolidMolecular weight:219.25974-(2-Methyl-1,3-thiazol-4-yl)benzoic acid
CAS:4-(2-Methyl-1,3-thiazol-4-yl)benzoic acidPurity:≥95%Color and Shape:PowderMolecular weight:219.26g/mol4-(2-Methyl-1,3-thiazol-4-yl)benzoic acid
CAS:Formula:C11H9NO2SPurity:95.0%Color and Shape:SolidMolecular weight:219.264-(2-Methyl-1,3-thiazol-4-yl)benzoic acid
CAS:4-(2-Methyl-1,3-thiazol-4-yl)benzoic acid (4MTBA) is a benzoic acid. It is used in the synthesis of other compounds such as an antiviral agent, an antifungal agent, and a herbicide. 4MTBA has been shown to be effective against herpes viruses and Candida albicans. The compound also has herbicidal properties that are similar to those of 2,4-dichlorophenoxyacetic acid (2,4-D).Formula:C11H9NO2SPurity:Min. 95%Molecular weight:219.26 g/mol



