CAS 29463-45-4
:Polymyrcene
Description:
Polymyrcene is a polymer derived from myrcene, a natural hydrocarbon found in various essential oils, particularly in the oil of bay leaves and hops. It is characterized by its rubber-like properties and is classified as a type of polyisoprene. Polymyrcene exhibits a high degree of elasticity and flexibility, making it suitable for applications in the production of rubber and other elastomeric materials. The polymer is typically amorphous, which contributes to its soft and pliable nature. Additionally, polymyrcene is known for its resistance to UV light and oxidation, enhancing its durability in various environmental conditions. Its chemical structure consists of repeating units of isoprene, which can vary in molecular weight depending on the polymerization process. Polymyrcene is also biodegradable, making it an environmentally friendly alternative to synthetic polymers. Due to these characteristics, it finds applications in industries such as adhesives, coatings, and sealants, as well as in the formulation of certain consumer products.
Formula:(C10H16)x
InChI:InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3
InChI key:InChIKey=UAHWPYUMFXYFJY-UHFFFAOYSA-N
SMILES:C(CCC=C(C)C)(C=C)=C
Synonyms:- 1,6-Octadiene, 7-methyl-3-methylene-, homopolymer
- Polymyrcene
- Myrcene polymer
- Myrcene homopolymer
- Poly(7-methyl-3-methylene-1,6-octadiene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
