CAS 294674-05-8
:(+)-Ganoderic acid ε
Description:
(+)-Ganoderic acid ε is a triterpenoid compound derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This substance is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. It exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in both traditional medicine and modern pharmacological research. The compound is typically found in the fruiting bodies and mycelium of the Ganoderma species, contributing to the mushroom's reputed health benefits. (+)-Ganoderic acid ε is also known for its ability to modulate various biological pathways, which may enhance immune function and promote overall wellness. Its solubility properties can vary, often being more soluble in organic solvents than in water, which is a common characteristic of many triterpenoids. As research continues, the potential therapeutic applications of this compound are being explored, particularly in the context of natural product chemistry and integrative health approaches.
Formula:C30H44O7
InChI:InChI=1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h11,15,17-19,21-22,31-32,34H,8-10,12-14H2,1-7H3,(H,36,37)/b16-11+/t15-,17+,18-,19+,21+,22+,28+,29-,30+/m1/s1
InChI key:InChIKey=MIWGXXQCEDNROQ-UZOYOLKESA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](C[C@@H](/C=C(/C(O)=O)\C)O)C)(CC2=O)[H]
Synonyms:- (+)-Ganoderic acid ε
- Lanosta-8,24-dien-26-oic acid, 3,7,23-trihydroxy-11,15-dioxo-, (3β,7β,23S,24E)-
- Ganoderic acid ε
- (3β,7β,23S,24E)-3,7,23-Trihydroxy-11,15-dioxolanosta-8,24-dien-26-oic acid
- Ganoderic acid Epsilon
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ganoderic acid ε
CAS:Ganoderic acid ε, a naturally occurring terpenoid, is extracted from the Fungus Ganoderma lucidum.Formula:C30H44O7Color and Shape:SolidMolecular weight:516.675Ganoderic acid epsilon
CAS:Controlled ProductGanoderic acid epsilon is a bioactive compound, which is a lanostane-type triterpene. It is sourced from the medicinal mushroom Ganoderma lucidum, commonly known as Reishi or Lingzhi, which has been used in traditional medicine for centuries. The mode of action of ganoderic acid epsilon involves the modulation of various cellular pathways, including anti-inflammatory, anti-tumor, and immunomodulatory effects. This compound can inhibit certain signaling pathways and enzymes involved in the proliferation and survival of cancer cells, making it a promising candidate for cancer therapy.Formula:C30H44O7Purity:Min. 95%Molecular weight:516.7 g/mol


