CAS 294674-09-2
:(3β,23S,24E)-3,23-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid
Description:
The chemical substance known as (3β,23S,24E)-3,23-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid, with the CAS number 294674-09-2, is a complex organic compound characterized by its unique trioxolane structure and multiple hydroxyl functional groups. This compound belongs to the class of triterpenoids, which are known for their diverse biological activities. The presence of multiple hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity in various chemical reactions. The specific stereochemistry indicated by the (3β,23S) configuration suggests that it has distinct spatial arrangements that could influence its biological interactions and pharmacological properties. Additionally, the presence of a double bond in the 24-position (24E) indicates that it may participate in various chemical transformations. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents, although further studies would be necessary to fully elucidate its biological activity and potential uses.
Formula:C30H42O7
InChI:InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h11,15,17-18,21-22,31,34H,8-10,12-14H2,1-7H3,(H,36,37)/b16-11+/t15-,17+,18-,21+,22+,28+,29-,30+/m1/s1
InChI key:InChIKey=PRJBNEAPLDQWLQ-AVCLMWMBSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](C[C@@H](/C=C(/C(O)=O)\C)O)C)(CC2=O)[H]
Synonyms:- Genoderic acid ζ
- Lanosta-8,24-dien-26-oic acid, 3,23-dihydroxy-7,11,15-trioxo-, (3β,23S,24E)-
- Ganoderic acid ζ
- (3β,23S,24E)-3,23-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid
- (+)-Ganoderic acid ζ
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ganoderic acid ζ
CAS:<p>The binding affinities of ganoderic acid DM and ganoderic acid Z (ÎGbind, -16.83 and-10.99 kcal mol-1) are comparable to that of current commercial drug</p>Formula:C30H42O7Purity:98%Color and Shape:SolidMolecular weight:514.659Ganoderic acid Z
CAS:<p>Ganoderic acid Z is a triterpenoid compound, which is sourced from the medicinal mushroom Ganoderma lucidum, commonly known as Reishi. This compound belongs to a class of bioactive constituents, specifically lanostanoid triterpenes, prevalent in this fungal species. Ganoderic acid Z exerts its effects through various biochemical pathways, primarily involving modulation of oxidative stress, inhibition of inflammatory mediators, and interaction with cellular signaling pathways related to apoptosis and cell cycle regulation.</p>Formula:C30H42O7Purity:Min. 95%Molecular weight:514.60 g/mol


