CAS 294675-79-9
:3-(2-Aminoethyl)-5-[(4-ethoxyphenyl)methylene]-2,4-thiazolidinedione
Description:
3-(2-Aminoethyl)-5-[(4-ethoxyphenyl)methylene]-2,4-thiazolidinedione, with CAS number 294675-79-9, is a thiazolidinedione derivative characterized by its unique molecular structure, which includes a thiazolidinedione core, an ethylamine side chain, and a substituted phenyl group. This compound typically exhibits properties associated with thiazolidinediones, such as potential anti-diabetic activity, due to its ability to modulate insulin sensitivity. The presence of the ethoxyphenyl group may enhance its lipophilicity and influence its biological activity. Additionally, the aminoethyl group can participate in various interactions, potentially affecting the compound's solubility and reactivity. Thiazolidinediones are known for their role in the regulation of glucose metabolism and may also exhibit anti-inflammatory properties. The compound's specific characteristics, including melting point, solubility, and spectral data, would require empirical determination or literature reference for precise values. Overall, this compound represents a class of molecules with significant pharmacological interest, particularly in metabolic disorders.
Formula:C14H16N2O3S
InChI:InChI=1S/C14H16N2O3S/c1-2-19-11-5-3-10(4-6-11)9-12-13(17)16(8-7-15)14(18)20-12/h3-6,9H,2,7-8,15H2,1H3
InChI key:InChIKey=NBJOUCGADPALIB-UHFFFAOYSA-N
SMILES:C(=C1C(=O)N(CCN)C(=O)S1)C2=CC=C(OCC)C=C2
Synonyms:- 2,4-Thiazolidinedione, 3-(2-aminoethyl)-5-[(4-ethoxyphenyl)methylene]-
- 3-(2-Aminoethyl)-5-[(4-ethoxyphenyl)methylene]-2,4-thiazolidinedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(2-Aminoethyl)-5-((4-ethoxyphenyl)methylene)-2,4-thiazolidinedione hydrochloride
CAS:Formula:C14H16N2O3S·HClMolecular weight:328.81Erk Inhibitor
CAS:<p>Erk inhibitor is a pharmacological agent that inhibits the activation of Erk and is used to treat cancer. It has been shown to inhibit the growth of breast cancer cells by binding to integrin receptors on the cell surface. Erk inhibitor has minimal toxicity in animal models, as well as minimal side effects in humans. The drug also binds to DNA and prevents transcriptional activity, leading to neuronal death. Erk inhibitor can inhibit epithelial-mesenchymal transition (EMT) by blocking the Mcl-1 protein, which is an important regulator of EMT. This drug may be a potential biomarker for cancer because it inhibits c-jun phosphorylation, which is an important step in carcinogenesis.</p>Formula:C14H17ClN2O3SPurity:Min. 95%Molecular weight:328.8 g/mol

