CAS 2947-02-6
:4-[1-Methoxy-2-(methylamino)ethyl]-1,2-benzenediol
Description:
4-[1-Methoxy-2-(methylamino)ethyl]-1,2-benzenediol, also known by its CAS number 2947-02-6, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with hydroxyl groups and an ether functional group. This compound features a methoxy group and a methylamino group, contributing to its potential biological activity. The presence of the hydroxyl groups suggests that it may exhibit properties typical of phenolic compounds, such as antioxidant activity. Its methoxy and methylamino substituents can influence its solubility and reactivity, making it of interest in medicinal chemistry and pharmacology. The compound's molecular structure allows for various interactions with biological systems, which may lead to applications in drug development or as a biochemical probe. However, detailed studies on its pharmacokinetics, toxicity, and specific biological effects would be necessary to fully understand its potential uses and safety profile.
Formula:C10H15NO3
InChI:InChI=1S/C10H15NO3/c1-11-6-10(14-2)7-3-4-8(12)9(13)5-7/h3-5,10-13H,6H2,1-2H3
SMILES:CNCC(c1ccc(c(c1)O)O)OC
Synonyms:- 4-(1-Methoxy-2-(Methylamino)Ethyl)Benzene-1,2-Diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
